C26H27ClN6O2 — CID 163376370
1-[4-[3-[2-[4-amino-5-(4-chloro-3-hydroxyphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 163376370) has the molecular formula C26H27ClN6O2 and a molecular weight of 491.00 g/mol. Its IUPAC name is 1-[4-[3-[2-[4-amino-5-(4-chloro-3-hydroxyphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[2-[4-amino-5-(4-chloro-3-hydroxyphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163376370 |
| Molecular Formula | C26H27ClN6O2 |
| Molecular Weight | 491.00 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 1-[4-[3-[2-[4-amino-5-(4-chloro-3-hydroxyphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(N2CC(C#Cc3c(-c4ccc(Cl)c(O)c4)c4c(N)ncnc4n3C)C2)CC1 |
| InChI | InChI=1S/C26H27ClN6O2/c1-3-22(35)32-10-8-18(9-11-32)33-13-16(14-33)4-7-20-23(17-5-6-19(27)21(34)12-17)24-25(28)29-15-30-26(24)31(20)2/h3,5-6,12,15-16,18,34H,1,8-11,13-14H2,2H3,(H2,28,29,30) |
| InChIKey | HDXKITDKMJTVKW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.00 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|