C31H32N6O — CID 163376563
1-[4-[2-[4-amino-5-(4-anilinophenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 163376563) has the molecular formula C31H32N6O and a molecular weight of 504.64 g/mol. Its IUPAC name is 1-[4-[2-[4-amino-5-(4-anilinophenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-[4-amino-5-(4-anilinophenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163376563 |
| Molecular Formula | C31H32N6O |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 1-[4-[2-[4-amino-5-(4-anilinophenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C#Cc2c(-c3ccc(Nc4ccccc4)cc3)c3c(N)ncnc3n2C(C)C)CC1 |
| InChI | InChI=1S/C31H32N6O/c1-4-27(38)36-18-16-22(17-19-36)10-15-26-28(29-30(32)33-20-34-31(29)37(26)21(2)3)23-11-13-25(14-12-23)35-24-8-6-5-7-9-24/h4-9,11-14,20-22,35H,1,16-19H2,2-3H3,(H2,32,33,34) |
| InChIKey | BDORNXFERBSQBP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|