C29H31N5O3S — CID 163376625
6-[2-(1-methylsulfonylpiperidin-4-yl)ethynyl]-5-(4-phenoxyphenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 163376625) has the molecular formula C29H31N5O3S and a molecular weight of 529.67 g/mol. Its IUPAC name is 6-[2-(1-methylsulfonylpiperidin-4-yl)ethynyl]-5-(4-phenoxyphenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-[2-(1-methylsulfonylpiperidin-4-yl)ethynyl]-5-(4-phenoxyphenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163376625 |
| Molecular Formula | C29H31N5O3S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 6-[2-(1-methylsulfonylpiperidin-4-yl)ethynyl]-5-(4-phenoxyphenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)n1c(C#CC2CCN(S(C)(=O)=O)CC2)c(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C29H31N5O3S/c1-20(2)34-25(14-9-21-15-17-33(18-16-21)38(3,35)36)26(27-28(30)31-19-32-29(27)34)22-10-12-24(13-11-22)37-23-7-5-4-6-8-23/h4-8,10-13,19-21H,15-18H2,1-3H3,(H2,30,31,32) |
| InChIKey | UVGZRDHEDSHNBI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|