C32H33N5O2 — CID 163376453
1-[4-[2-[4-amino-5-[4-(3-methylphenoxy)phenyl]-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 163376453) has the molecular formula C32H33N5O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 1-[4-[2-[4-amino-5-[4-(3-methylphenoxy)phenyl]-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-[4-amino-5-[4-(3-methylphenoxy)phenyl]-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163376453 |
| Molecular Formula | C32H33N5O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 1-[4-[2-[4-amino-5-[4-(3-methylphenoxy)phenyl]-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C#Cc2c(-c3ccc(Oc4cccc(C)c4)cc3)c3c(N)ncnc3n2C(C)C)CC1 |
| InChI | InChI=1S/C32H33N5O2/c1-5-28(38)36-17-15-23(16-18-36)9-14-27-29(30-31(33)34-20-35-32(30)37(27)21(2)3)24-10-12-25(13-11-24)39-26-8-6-7-22(4)19-26/h5-8,10-13,19-21,23H,1,15-18H2,2-4H3,(H2,33,34,35) |
| InChIKey | RRXZGDUNVVQETB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|