C30H31N5O2 — CID 163376511
1-[4-[2-[4-amino-5-(4-phenoxyphenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]ethanone (PubChem CID 163376511) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 1-[4-[2-[4-amino-5-(4-phenoxyphenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[4-amino-5-(4-phenoxyphenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 163376511 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 1-[4-[2-[4-amino-5-(4-phenoxyphenyl)-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl]ethynyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C#Cc2c(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc3n2C(C)C)CC1 |
| InChI | InChI=1S/C30H31N5O2/c1-20(2)35-26(14-9-22-15-17-34(18-16-22)21(3)36)27(28-29(31)32-19-33-30(28)35)23-10-12-25(13-11-23)37-24-7-5-4-6-8-24/h4-8,10-13,19-20,22H,15-18H2,1-3H3,(H2,31,32,33) |
| InChIKey | UQUPACMORWHSGR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|