C19H20BrN5O — CID 163376716
1-[(1R,5S)-6-[2-(4-amino-5-bromo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl)ethynyl]-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one (PubChem CID 163376716) has the molecular formula C19H20BrN5O and a molecular weight of 414.31 g/mol. Its IUPAC name is 1-[(1R,5S)-6-[2-(4-amino-5-bromo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl)ethynyl]-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,5S)-6-[2-(4-amino-5-bromo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl)ethynyl]-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163376716 |
| Molecular Formula | C19H20BrN5O |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 1-[(1R,5S)-6-[2-(4-amino-5-bromo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-6-yl)ethynyl]-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H]2C(C#Cc3c(Br)c4c(N)ncnc4n3C(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C19H20BrN5O/c1-4-15(26)24-7-12-11(13(12)8-24)5-6-14-17(20)16-18(21)22-9-23-19(16)25(14)10(2)3/h4,9-13H,1,7-8H2,2-3H3,(H2,21,22,23)/t11?,12-,13+ |
| InChIKey | CYGFEGKUGXGBFV-YHWZYXNKSA-N |
| XLogP | 2.60 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|