C22H30ClN5O4 — CID 163377818
2-[2-chloro-6-[3-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-1-yl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 163377818) has the molecular formula C22H30ClN5O4 and a molecular weight of 463.97 g/mol. Its IUPAC name is 2-[2-chloro-6-[3-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-1-yl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[2-chloro-6-[3-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-1-yl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 163377818 |
| Molecular Formula | C22H30ClN5O4 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[2-chloro-6-[3-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-1-yl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C/C=C\C(=C/CC)C1CCCN(c2nc(Cl)nc3c2ncn3C2OC(CO)C(O)C2O)C1 |
| InChI | InChI=1S/C22H30ClN5O4/c1-3-6-13(7-4-2)14-8-5-9-27(10-14)19-16-20(26-22(23)25-19)28(12-24-16)21-18(31)17(30)15(11-29)32-21/h3,6-7,12,14-15,17-18,21,29-31H,4-5,8-11H2,1-2H3/b6-3-,13-7+ |
| InChIKey | TUENHRWFWZPFNI-VQOXRLQQSA-N |
| XLogP | 2.22 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|