About pyrimidin-4-yl hexanoate
pyrimidin-4-yl hexanoate (PubChem CID 163377842) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is pyrimidin-4-yl hexanoate.
Molecular Properties
| Compound Name | pyrimidin-4-yl hexanoate |
| PubChem CID | 163377842 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | pyrimidin-4-yl hexanoate |
| SMILES | CCCCCC(=O)Oc1ccncn1 |
| InChI | InChI=1S/C10H14N2O2/c1-2-3-4-5-10(13)14-9-6-7-11-8-12-9/h6-8H,2-5H2,1H3 |
| InChIKey | OZQCBIZIDIJTAV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pyrimidin-4-yl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-4-yl hexanoate?
The IUPAC name of pyrimidin-4-yl hexanoate (CID 163377842) is pyrimidin-4-yl hexanoate.
What is the SMILES notation for pyrimidin-4-yl hexanoate?
The canonical SMILES for pyrimidin-4-yl hexanoate is CCCCCC(=O)Oc1ccncn1.
What is the InChIKey of pyrimidin-4-yl hexanoate?
The InChIKey is OZQCBIZIDIJTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-2-3-4-5-10(13)14-9-6-7-11-8-12-9/h6-8H,2-5H2,1H3.
What are the key properties of pyrimidin-4-yl hexanoate?
pyrimidin-4-yl hexanoate has a molecular weight of 194.23 g/mol, XLogP of 1.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-4-yl hexanoate is sourced from PubChem (CID 163377842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).