About N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide
N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide (PubChem CID 163378899) has the molecular formula C17H20ClN3O4S
and a molecular weight of 397.88 g/mol. Its IUPAC name is N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide.
Molecular Properties
| Compound Name | N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide |
| PubChem CID | 163378899 |
| Molecular Formula | C17H20ClN3O4S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide |
| SMILES | NS(=O)(=O)CCC(=O)NC1CC2(C1)CC(c1nc3cc(Cl)ccc3o1)C2 |
| InChI | InChI=1S/C17H20ClN3O4S/c18-11-1-2-14-13(5-11)21-16(25-14)10-6-17(7-10)8-12(9-17)20-15(22)3-4-26(19,23)24/h1-2,5,10,12H,3-4,6-9H2,(H,20,22)(H2,19,23,24) |
| InChIKey | ZYWZFLUCXADIRE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide?
The IUPAC name of N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide (CID 163378899) is N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide.
What is the SMILES notation for N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide?
The canonical SMILES for N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide is NS(=O)(=O)CCC(=O)NC1CC2(C1)CC(c1nc3cc(Cl)ccc3o1)C2.
What is the InChIKey of N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide?
The InChIKey is ZYWZFLUCXADIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O4S/c18-11-1-2-14-13(5-11)21-16(25-14)10-6-17(7-10)8-12(9-17)20-15(22)3-4-26(19,23)24/h1-2,5,10,12H,3-4,6-9H2,(H,20,22)(H2,19,23,24).
What are the key properties of N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide?
N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide has a molecular weight of 397.88 g/mol, XLogP of 2.30, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-2-yl]-3-sulfamoylpropanamide is sourced from PubChem (CID 163378899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).