C18H23ClN2O2 — CID 167088226
N-[4-(5-chloro-1,3-benzoxazol-2-yl)cyclohexyl]-2,2-dimethylpropanamide (PubChem CID 167088226) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is N-[4-(5-chloro-1,3-benzoxazol-2-yl)cyclohexyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)cyclohexyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 167088226 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)cyclohexyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1CCC(c2nc3cc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C18H23ClN2O2/c1-18(2,3)17(22)20-13-7-4-11(5-8-13)16-21-14-10-12(19)6-9-15(14)23-16/h6,9-11,13H,4-5,7-8H2,1-3H3,(H,20,22) |
| InChIKey | GQDFVJQTOWJLRN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |