C24H23N3O5 — CID 163379323
N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxamide (PubChem CID 163379323) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxamide.
| Compound Name | N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 163379323 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2ccc(OCc3ccccc3)cc2c1C(=O)N[C@H]1C[C@H]2C(=O)NCC(=O)N2C1 |
| InChI | InChI=1S/C24H23N3O5/c1-14-22(24(30)26-16-9-19-23(29)25-11-21(28)27(19)12-16)18-10-17(7-8-20(18)32-14)31-13-15-5-3-2-4-6-15/h2-8,10,16,19H,9,11-13H2,1H3,(H,25,29)(H,26,30)/t16-,19-/m0/s1 |
| InChIKey | DKDXRVGNHKKFKI-LPHOPBHVSA-N |
| XLogP | 2.15 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |