C26H33N3O4S — CID 163379658
5-[3-(dimethylamino)-1-phenylpropoxy]-2-methyl-N-(2-oxopyrrolidin-3-yl)-1-benzofuran-3-carboxamide;methanethiol (PubChem CID 163379658) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 5-[3-(dimethylamino)-1-phenylpropoxy]-2-methyl-N-(2-oxopyrrolidin-3-yl)-1-benzofuran-3-carboxamide;methanethiol.
| Compound Name | 5-[3-(dimethylamino)-1-phenylpropoxy]-2-methyl-N-(2-oxopyrrolidin-3-yl)-1-benzofuran-3-carboxamide;methanethiol |
|---|---|
| PubChem CID | 163379658 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 5-[3-(dimethylamino)-1-phenylpropoxy]-2-methyl-N-(2-oxopyrrolidin-3-yl)-1-benzofuran-3-carboxamide;methanethiol |
| SMILES | CS.Cc1oc2ccc(OC(CCN(C)C)c3ccccc3)cc2c1C(=O)NC1CCNC1=O |
| InChI | InChI=1S/C25H29N3O4.CH4S/c1-16-23(25(30)27-20-11-13-26-24(20)29)19-15-18(9-10-22(19)31-16)32-21(12-14-28(2)3)17-7-5-4-6-8-17;1-2/h4-10,15,20-21H,11-14H2,1-3H3,(H,26,29)(H,27,30);2H,1H3 |
| InChIKey | YKIPGRFQACECTH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|