C23H29NO2 — CID 163382230
N-[4-[3-ethyl-2-(2-methylpropanoyl)phenyl]-2-methylphenyl]-N-methylpropanamide (PubChem CID 163382230) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[4-[3-ethyl-2-(2-methylpropanoyl)phenyl]-2-methylphenyl]-N-methylpropanamide.
| Compound Name | N-[4-[3-ethyl-2-(2-methylpropanoyl)phenyl]-2-methylphenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 163382230 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[4-[3-ethyl-2-(2-methylpropanoyl)phenyl]-2-methylphenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(-c2cccc(CC)c2C(=O)C(C)C)cc1C |
| InChI | InChI=1S/C23H29NO2/c1-7-17-10-9-11-19(22(17)23(26)15(3)4)18-12-13-20(16(5)14-18)24(6)21(25)8-2/h9-15H,7-8H2,1-6H3 |
| InChIKey | BEVUJZAGEXYMMO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |