C32H25BrF3N5O3 — CID 163384026
4-[5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide (PubChem CID 163384026) has the molecular formula C32H25BrF3N5O3 and a molecular weight of 664.48 g/mol. Its IUPAC name is 4-[5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide.
| Compound Name | 4-[5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 163384026 |
| Molecular Formula | C32H25BrF3N5O3 |
| Molecular Weight | 664.48 g/mol |
| Exact Mass | 663.11 |
| IUPAC Name | 4-[5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-n2c(=O)c3c(n4ncc(Cc5ccccc5)c24)CN(C(=O)c2ccc(Br)c(C(F)(F)F)c2)CC3)cc1 |
| InChI | InChI=1S/C32H25BrF3N5O3/c1-37-28(42)20-7-10-23(11-8-20)40-29-22(15-19-5-3-2-4-6-19)17-38-41(29)27-18-39(14-13-24(27)31(40)44)30(43)21-9-12-26(33)25(16-21)32(34,35)36/h2-12,16-17H,13-15,18H2,1H3,(H,37,42) |
| InChIKey | VVLUHWPDXHHDPZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |