C32H27BrF3N5O3 — CID 168664451
5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-7-[4-(methylaminooxymethyl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 168664451) has the molecular formula C32H27BrF3N5O3 and a molecular weight of 666.50 g/mol. Its IUPAC name is 5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-7-[4-(methylaminooxymethyl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | 5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-7-[4-(methylaminooxymethyl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 168664451 |
| Molecular Formula | C32H27BrF3N5O3 |
| Molecular Weight | 666.50 g/mol |
| Exact Mass | 665.12 |
| IUPAC Name | 5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-7-[4-(methylaminooxymethyl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | CNOCc1ccc(-n2c(=O)c3c(n4ncc(Cc5ccccc5)c24)CN(C(=O)c2ccc(Br)c(C(F)(F)F)c2)CC3)cc1 |
| InChI | InChI=1S/C32H27BrF3N5O3/c1-37-44-19-21-7-10-24(11-8-21)40-29-23(15-20-5-3-2-4-6-20)17-38-41(29)28-18-39(14-13-25(28)31(40)43)30(42)22-9-12-27(33)26(16-22)32(34,35)36/h2-12,16-17,37H,13-15,18-19H2,1H3 |
| InChIKey | ZCGPIELBVJWYEU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|