C24H32N4O10S — CID 163384594
5-[[(2S)-2-[[2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-2-(hydroxymethyl)benzenesulfonic acid (PubChem CID 163384594) has the molecular formula C24H32N4O10S and a molecular weight of 568.61 g/mol. Its IUPAC name is 5-[[(2S)-2-[[2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-2-(hydroxymethyl)benzenesulfonic acid.
| Compound Name | 5-[[(2S)-2-[[2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-2-(hydroxymethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 163384594 |
| Molecular Formula | C24H32N4O10S |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 5-[[(2S)-2-[[2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-2-(hydroxymethyl)benzenesulfonic acid |
| SMILES | CC(C)C(NC(=O)CCOCCN1C(=O)C=CC1=O)C(=O)N[C@@H](C)C(=O)Nc1ccc(CO)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C24H32N4O10S/c1-14(2)22(27-19(30)8-10-38-11-9-28-20(31)6-7-21(28)32)24(34)25-15(3)23(33)26-17-5-4-16(13-29)18(12-17)39(35,36)37/h4-7,12,14-15,22,29H,8-11,13H2,1-3H3,(H,25,34)(H,26,33)(H,27,30)(H,35,36,37)/t15-,22?/m0/s1 |
| InChIKey | CPASJWISGNKJMF-UEDXYCIISA-N |
| XLogP | -0.66 |
| TPSA | 208.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|