C38H77NO3 — CID 163385039
hexadecanal;N-methylmethanamine;[(E,4S)-nonadec-5-en-4-yl] formate (PubChem CID 163385039) has the molecular formula C38H77NO3 and a molecular weight of 596.04 g/mol. Its IUPAC name is hexadecanal;N-methylmethanamine;[(E,4S)-nonadec-5-en-4-yl] formate.
| Compound Name | hexadecanal;N-methylmethanamine;[(E,4S)-nonadec-5-en-4-yl] formate |
|---|---|
| PubChem CID | 163385039 |
| Molecular Formula | C38H77NO3 |
| Molecular Weight | 596.04 g/mol |
| Exact Mass | 595.59 |
| IUPAC Name | hexadecanal;N-methylmethanamine;[(E,4S)-nonadec-5-en-4-yl] formate |
| SMILES | CCCCCCCCCCCCC/C=C/[C@H](CCC)OC=O.CCCCCCCCCCCCCCCC=O.CNC |
| InChI | InChI=1S/C20H38O2.C16H32O.C2H7N/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-18-20(17-4-2)22-19-21;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17;1-3-2/h16,18-20H,3-15,17H2,1-2H3;16H,2-15H2,1H3;3H,1-2H3/b18-16+;;/t20-;;/m0../s1 |
| InChIKey | RLVZVGANLJRXGO-GVWJYTFFSA-N |
| XLogP | 12.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.04 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|