C12H20O2 — CID 173393596
undeca-1,5-dien-4-yl formate (PubChem CID 173393596) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is undeca-1,5-dien-4-yl formate.
| Compound Name | undeca-1,5-dien-4-yl formate |
|---|---|
| PubChem CID | 173393596 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | undeca-1,5-dien-4-yl formate |
| SMILES | C=CCC(C=CCCCCC)OC=O |
| InChI | InChI=1S/C12H20O2/c1-3-5-6-7-8-10-12(9-4-2)14-11-13/h4,8,10-12H,2-3,5-7,9H2,1H3 |
| InChIKey | DZLWSJSDUAVPOV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|