C27H37BN4O2 — CID 163387061
CID 163387061 (PubChem CID 163387061) has the molecular formula C27H37BN4O2 and a molecular weight of 460.43 g/mol.
| Compound Name | CID 163387061 |
|---|---|
| PubChem CID | 163387061 |
| Molecular Formula | C27H37BN4O2 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)CCC21CC1NC(=O)C1CCCN1C(=O)C(N/C=C(\N)C1CC1)C(C)(C)C |
| InChI | InChI=1S/C27H37BN4O2/c1-26(2,3)23(30-15-20(29)16-6-7-16)25(34)32-12-4-5-21(32)24(33)31-22-14-27(22)11-10-17-13-18(28)8-9-19(17)27/h8-9,13,15-16,21-23,30H,4-7,10-12,14,29H2,1-3H3,(H,31,33)/b20-15- |
| InChIKey | YLVKFZZXFBIUHU-HKWRFOASSA-N |
| XLogP | 1.76 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|