C16H25N3O4 — CID 163392246
methyl 2-(hydroxymethyl)-3-[2-(oxan-2-yl)pyrazol-3-yl]piperidine-1-carboxylate (PubChem CID 163392246) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is methyl 2-(hydroxymethyl)-3-[2-(oxan-2-yl)pyrazol-3-yl]piperidine-1-carboxylate.
| Compound Name | methyl 2-(hydroxymethyl)-3-[2-(oxan-2-yl)pyrazol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163392246 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | methyl 2-(hydroxymethyl)-3-[2-(oxan-2-yl)pyrazol-3-yl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(c2ccnn2C2CCCCO2)C1CO |
| InChI | InChI=1S/C16H25N3O4/c1-22-16(21)18-9-4-5-12(14(18)11-20)13-7-8-17-19(13)15-6-2-3-10-23-15/h7-8,12,14-15,20H,2-6,9-11H2,1H3 |
| InChIKey | FFNZKWGGVVELND-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |