C11H15N3O — CID 163393165
3-[2-(dimethylamino)ethyl]-1H-pyrrolo[2,3-c]pyridin-4-ol (PubChem CID 163393165) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1H-pyrrolo[2,3-c]pyridin-4-ol.
| Compound Name | 3-[2-(dimethylamino)ethyl]-1H-pyrrolo[2,3-c]pyridin-4-ol |
|---|---|
| PubChem CID | 163393165 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1H-pyrrolo[2,3-c]pyridin-4-ol |
| SMILES | CN(C)CCc1c[nH]c2cncc(O)c12 |
| InChI | InChI=1S/C11H15N3O/c1-14(2)4-3-8-5-13-9-6-12-7-10(15)11(8)9/h5-7,13,15H,3-4H2,1-2H3 |
| InChIKey | SCVPOPYMBMRVIP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |