C14H31N — CID 163393241
2-butyl-1,6-dimethylazepane;ethane (PubChem CID 163393241) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is 2-butyl-1,6-dimethylazepane;ethane.
| Compound Name | 2-butyl-1,6-dimethylazepane;ethane |
|---|---|
| PubChem CID | 163393241 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 2-butyl-1,6-dimethylazepane;ethane |
| SMILES | CC.CCCCC1CCCC(C)CN1C |
| InChI | InChI=1S/C12H25N.C2H6/c1-4-5-8-12-9-6-7-11(2)10-13(12)3;1-2/h11-12H,4-10H2,1-3H3;1-2H3 |
| InChIKey | RVJBAWTVCWXILK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |