C12H21N — CID 163393614
N-[(1Z)-buta-1,3-dienyl]-4-methylpent-1-en-3-imine;ethane (PubChem CID 163393614) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-4-methylpent-1-en-3-imine;ethane.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-4-methylpent-1-en-3-imine;ethane |
|---|---|
| PubChem CID | 163393614 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-4-methylpent-1-en-3-imine;ethane |
| SMILES | C=C/C=C\N=C(/C=C)C(C)C.CC |
| InChI | InChI=1S/C10H15N.C2H6/c1-5-7-8-11-10(6-2)9(3)4;1-2/h5-9H,1-2H2,3-4H3;1-2H3/b8-7-,11-10+; |
| InChIKey | ORXOOMGDGHDZKZ-NSXGYBNXSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|