C19H19F3N4O2 — CID 163393745
ethane-1,2-diimine;5-[4-methyl-3-[3-(trifluoromethyl)phenoxy]phenyl]-4,5-dihydro-1,2-oxazol-3-amine (PubChem CID 163393745) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is ethane-1,2-diimine;5-[4-methyl-3-[3-(trifluoromethyl)phenoxy]phenyl]-4,5-dihydro-1,2-oxazol-3-amine.
| Compound Name | ethane-1,2-diimine;5-[4-methyl-3-[3-(trifluoromethyl)phenoxy]phenyl]-4,5-dihydro-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 163393745 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | ethane-1,2-diimine;5-[4-methyl-3-[3-(trifluoromethyl)phenoxy]phenyl]-4,5-dihydro-1,2-oxazol-3-amine |
| SMILES | Cc1ccc(C2CC(N)=NO2)cc1Oc1cccc(C(F)(F)F)c1.[H]/N=C/C=N/[H] |
| InChI | InChI=1S/C17H15F3N2O2.C2H4N2/c1-10-5-6-11(15-9-16(21)22-24-15)7-14(10)23-13-4-2-3-12(8-13)17(18,19)20;3-1-2-4/h2-8,15H,9H2,1H3,(H2,21,22);1-4H/b;3-1+,4-2+ |
| InChIKey | ANSJHFQPUHIEIV-BZGZIVBQSA-N |
| XLogP | 4.83 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|