About 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole
3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole (PubChem CID 164596073) has the molecular formula C18H18BrFN2O2
and a molecular weight of 393.26 g/mol. Its IUPAC name is 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole |
| PubChem CID | 164596073 |
| Molecular Formula | C18H18BrFN2O2 |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole |
| SMILES | Cc1cnc(C2CC(Br)=NO2)cc1Oc1cccc(C(C)(C)F)c1 |
| InChI | InChI=1S/C18H18BrFN2O2/c1-11-10-21-14(16-9-17(19)22-24-16)8-15(11)23-13-6-4-5-12(7-13)18(2,3)20/h4-8,10,16H,9H2,1-3H3 |
| InChIKey | VZAMKBRZCIVWCE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole?
The IUPAC name of 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole (CID 164596073) is 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole is Cc1cnc(C2CC(Br)=NO2)cc1Oc1cccc(C(C)(C)F)c1.
What is the InChIKey of 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole?
The InChIKey is VZAMKBRZCIVWCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrFN2O2/c1-11-10-21-14(16-9-17(19)22-24-16)8-15(11)23-13-6-4-5-12(7-13)18(2,3)20/h4-8,10,16H,9H2,1-3H3.
What are the key properties of 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole?
3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole has a molecular weight of 393.26 g/mol, XLogP of 5.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-[4-[3-(2-fluoropropan-2-yl)phenoxy]-5-methyl-2-pyridinyl]-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 164596073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).