C23H31NO — CID 163393859
3-[2,4-dimethyl-4-(4-propan-2-ylphenyl)pentan-2-yl]benzamide (PubChem CID 163393859) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 3-[2,4-dimethyl-4-(4-propan-2-ylphenyl)pentan-2-yl]benzamide.
| Compound Name | 3-[2,4-dimethyl-4-(4-propan-2-ylphenyl)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 163393859 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 3-[2,4-dimethyl-4-(4-propan-2-ylphenyl)pentan-2-yl]benzamide |
| SMILES | CC(C)c1ccc(C(C)(C)CC(C)(C)c2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C23H31NO/c1-16(2)17-10-12-19(13-11-17)22(3,4)15-23(5,6)20-9-7-8-18(14-20)21(24)25/h7-14,16H,15H2,1-6H3,(H2,24,25) |
| InChIKey | CKLNCPBLGKRVOV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |