C21H24N4O4 — CID 163394557
4-[[(2S)-2-amino-3-[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]propanoyl]amino]benzoic acid (PubChem CID 163394557) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-[[(2S)-2-amino-3-[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-amino-3-[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 163394557 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-[[(2S)-2-amino-3-[4-(4-methyl-2-oxopiperazin-1-yl)phenyl]propanoyl]amino]benzoic acid |
| SMILES | CN1CCN(c2ccc(C[C@H](N)C(=O)Nc3ccc(C(=O)O)cc3)cc2)C(=O)C1 |
| InChI | InChI=1S/C21H24N4O4/c1-24-10-11-25(19(26)13-24)17-8-2-14(3-9-17)12-18(22)20(27)23-16-6-4-15(5-7-16)21(28)29/h2-9,18H,10-13,22H2,1H3,(H,23,27)(H,28,29)/t18-/m0/s1 |
| InChIKey | KSTMQVRLZJQUMQ-SFHVURJKSA-N |
| XLogP | 1.17 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |