C22H26N4O4 — CID 175395740
4-[[(2S)-2-amino-3-[4-(4-ethyl-2-oxopiperazin-1-yl)phenyl]propanoyl]amino]benzoic acid (PubChem CID 175395740) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-[[(2S)-2-amino-3-[4-(4-ethyl-2-oxopiperazin-1-yl)phenyl]propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-amino-3-[4-(4-ethyl-2-oxopiperazin-1-yl)phenyl]propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175395740 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-[[(2S)-2-amino-3-[4-(4-ethyl-2-oxopiperazin-1-yl)phenyl]propanoyl]amino]benzoic acid |
| SMILES | CCN1CCN(c2ccc(C[C@H](N)C(=O)Nc3ccc(C(=O)O)cc3)cc2)C(=O)C1 |
| InChI | InChI=1S/C22H26N4O4/c1-2-25-11-12-26(20(27)14-25)18-9-3-15(4-10-18)13-19(23)21(28)24-17-7-5-16(6-8-17)22(29)30/h3-10,19H,2,11-14,23H2,1H3,(H,24,28)(H,29,30)/t19-/m0/s1 |
| InChIKey | TVUCSYZDIVXFDJ-IBGZPJMESA-N |
| XLogP | 1.56 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |