C22H27F3N6O — CID 163399605
4-(diaminomethylideneamino)-N-[4-[[[2-methyl-6-(trifluoromethyl)-4-pyridinyl]amino]methyl]cyclohexyl]benzamide (PubChem CID 163399605) has the molecular formula C22H27F3N6O and a molecular weight of 448.49 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-N-[4-[[[2-methyl-6-(trifluoromethyl)-4-pyridinyl]amino]methyl]cyclohexyl]benzamide.
| Compound Name | 4-(diaminomethylideneamino)-N-[4-[[[2-methyl-6-(trifluoromethyl)-4-pyridinyl]amino]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 163399605 |
| Molecular Formula | C22H27F3N6O |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-(diaminomethylideneamino)-N-[4-[[[2-methyl-6-(trifluoromethyl)-4-pyridinyl]amino]methyl]cyclohexyl]benzamide |
| SMILES | Cc1cc(NCC2CCC(NC(=O)c3ccc(N=C(N)N)cc3)CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C22H27F3N6O/c1-13-10-18(11-19(29-13)22(23,24)25)28-12-14-2-6-16(7-3-14)30-20(32)15-4-8-17(9-5-15)31-21(26)27/h4-5,8-11,14,16H,2-3,6-7,12H2,1H3,(H,28,29)(H,30,32)(H4,26,27,31) |
| InChIKey | OHFHTKWFDYEERG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|