C22H34N4O4 — CID 163401701
N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]-4-[1-(4-methylpyrazol-1-yl)ethyl]benzamide (PubChem CID 163401701) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]-4-[1-(4-methylpyrazol-1-yl)ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]-4-[1-(4-methylpyrazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 163401701 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]-4-[1-(4-methylpyrazol-1-yl)ethyl]benzamide |
| SMILES | CNCCOCCOCCOCCNC(=O)c1ccc(C(C)n2cc(C)cn2)cc1 |
| InChI | InChI=1S/C22H34N4O4/c1-18-16-25-26(17-18)19(2)20-4-6-21(7-5-20)22(27)24-9-11-29-13-15-30-14-12-28-10-8-23-3/h4-7,16-17,19,23H,8-15H2,1-3H3,(H,24,27) |
| InChIKey | ROYFUGPPDGYTHH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|