C30H49N3O5 — CID 167386732
N-[2-[2-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethoxy]ethoxy]ethyl]-4-[1-(4-propan-2-ylpyrazol-1-yl)ethyl]benzamide (PubChem CID 167386732) has the molecular formula C30H49N3O5 and a molecular weight of 531.74 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethoxy]ethoxy]ethyl]-4-[1-(4-propan-2-ylpyrazol-1-yl)ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethoxy]ethoxy]ethyl]-4-[1-(4-propan-2-ylpyrazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 167386732 |
| Molecular Formula | C30H49N3O5 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.37 |
| IUPAC Name | N-[2-[2-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethoxy]ethoxy]ethyl]-4-[1-(4-propan-2-ylpyrazol-1-yl)ethyl]benzamide |
| SMILES | CC(C)c1cnn(C(C)c2ccc(C(=O)NCCOCCOCCOCCOCCCC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C30H49N3O5/c1-24(2)28-22-32-33(23-28)25(3)26-8-10-27(11-9-26)29(34)31-13-15-36-17-19-38-21-20-37-18-16-35-14-7-12-30(4,5)6/h8-11,22-25H,7,12-21H2,1-6H3,(H,31,34) |
| InChIKey | ILGAVGOCXJZUEU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|