C23H43N3O — CID 167418152
1-[4-(4,4-dimethylpentoxy)butyl]-4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidine (PubChem CID 167418152) has the molecular formula C23H43N3O and a molecular weight of 377.62 g/mol. Its IUPAC name is 1-[4-(4,4-dimethylpentoxy)butyl]-4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidine.
| Compound Name | 1-[4-(4,4-dimethylpentoxy)butyl]-4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 167418152 |
| Molecular Formula | C23H43N3O |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.34 |
| IUPAC Name | 1-[4-(4,4-dimethylpentoxy)butyl]-4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidine |
| SMILES | CC(C)c1cnn(CC2CCN(CCCCOCCCC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C23H43N3O/c1-20(2)22-17-24-26(19-22)18-21-9-13-25(14-10-21)12-6-7-15-27-16-8-11-23(3,4)5/h17,19-21H,6-16,18H2,1-5H3 |
| InChIKey | JZRHUHFIBZJZDJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|