C21H37N3O — CID 155741246
7-[4-[(4-butan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]-2-methylheptan-3-one (PubChem CID 155741246) has the molecular formula C21H37N3O and a molecular weight of 347.55 g/mol. Its IUPAC name is 7-[4-[(4-butan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]-2-methylheptan-3-one.
| Compound Name | 7-[4-[(4-butan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]-2-methylheptan-3-one |
|---|---|
| PubChem CID | 155741246 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | 7-[4-[(4-butan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]-2-methylheptan-3-one |
| SMILES | CCC(C)c1cnn(CC2CCN(CCCCC(=O)C(C)C)CC2)c1 |
| InChI | InChI=1S/C21H37N3O/c1-5-18(4)20-14-22-24(16-20)15-19-9-12-23(13-10-19)11-7-6-8-21(25)17(2)3/h14,16-19H,5-13,15H2,1-4H3 |
| InChIKey | ZIPXZEQPPXYAEB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|