C26H46N4O — CID 155740847
acetaldehyde;1-cyclohexyl-4-[[4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]piperidine (PubChem CID 155740847) has the molecular formula C26H46N4O and a molecular weight of 430.68 g/mol. Its IUPAC name is acetaldehyde;1-cyclohexyl-4-[[4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]piperidine.
| Compound Name | acetaldehyde;1-cyclohexyl-4-[[4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]piperidine |
|---|---|
| PubChem CID | 155740847 |
| Molecular Formula | C26H46N4O |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.37 |
| IUPAC Name | acetaldehyde;1-cyclohexyl-4-[[4-[(4-propan-2-ylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]piperidine |
| SMILES | CC(C)c1cnn(CC2CCN(CC3CCN(C4CCCCC4)CC3)CC2)c1.CC=O |
| InChI | InChI=1S/C24H42N4.C2H4O/c1-20(2)23-16-25-28(19-23)18-22-8-12-26(13-9-22)17-21-10-14-27(15-11-21)24-6-4-3-5-7-24;1-2-3/h16,19-22,24H,3-15,17-18H2,1-2H3;2H,1H3 |
| InChIKey | VMWDMXBVCNXPDH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|