About 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine
1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine (PubChem CID 155739616) has the molecular formula C21H40N4
and a molecular weight of 348.58 g/mol. Its IUPAC name is 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine |
| PubChem CID | 155739616 |
| Molecular Formula | C21H40N4 |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.33 |
| IUPAC Name | 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine |
| SMILES | CC(C)c1cnn(C2CCN(C3CCCCC3)CC2)c1.CNC(C)C |
| InChI | InChI=1S/C17H29N3.C4H11N/c1-14(2)15-12-18-20(13-15)17-8-10-19(11-9-17)16-6-4-3-5-7-16;1-4(2)5-3/h12-14,16-17H,3-11H2,1-2H3;4-5H,1-3H3 |
| InChIKey | MNPJLPHSLBGSAB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine?
The IUPAC name of 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine (CID 155739616) is 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine.
What is the SMILES notation for 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine?
The canonical SMILES for 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine is CC(C)c1cnn(C2CCN(C3CCCCC3)CC2)c1.CNC(C)C.
What is the InChIKey of 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine?
The InChIKey is MNPJLPHSLBGSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3.C4H11N/c1-14(2)15-12-18-20(13-15)17-8-10-19(11-9-17)16-6-4-3-5-7-16;1-4(2)5-3/h12-14,16-17H,3-11H2,1-2H3;4-5H,1-3H3.
What are the key properties of 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine?
1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine has a molecular weight of 348.58 g/mol, XLogP of 4.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-(4-propan-2-ylpyrazol-1-yl)piperidine;N-methylpropan-2-amine is sourced from PubChem (CID 155739616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).