C10H16N2OS — CID 172606973
3-(4-propan-2-ylpyrazol-1-yl)thiolane 1-oxide (PubChem CID 172606973) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 3-(4-propan-2-ylpyrazol-1-yl)thiolane 1-oxide.
| Compound Name | 3-(4-propan-2-ylpyrazol-1-yl)thiolane 1-oxide |
|---|---|
| PubChem CID | 172606973 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-(4-propan-2-ylpyrazol-1-yl)thiolane 1-oxide |
| SMILES | CC(C)c1cnn(C2CCS(=O)C2)c1 |
| InChI | InChI=1S/C10H16N2OS/c1-8(2)9-5-11-12(6-9)10-3-4-14(13)7-10/h5-6,8,10H,3-4,7H2,1-2H3 |
| InChIKey | FFVXKOQALOUBCE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |