C29H45N3O — CID 163401657
propanal;4-[(4-propan-2-ylpyrazol-1-yl)methyl]-1-[[4-(3-propylcyclobutyl)phenyl]methyl]piperidine (PubChem CID 163401657) has the molecular formula C29H45N3O and a molecular weight of 451.70 g/mol. Its IUPAC name is propanal;4-[(4-propan-2-ylpyrazol-1-yl)methyl]-1-[[4-(3-propylcyclobutyl)phenyl]methyl]piperidine.
| Compound Name | propanal;4-[(4-propan-2-ylpyrazol-1-yl)methyl]-1-[[4-(3-propylcyclobutyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 163401657 |
| Molecular Formula | C29H45N3O |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.36 |
| IUPAC Name | propanal;4-[(4-propan-2-ylpyrazol-1-yl)methyl]-1-[[4-(3-propylcyclobutyl)phenyl]methyl]piperidine |
| SMILES | CCC=O.CCCC1CC(c2ccc(CN3CCC(Cn4cc(C(C)C)cn4)CC3)cc2)C1 |
| InChI | InChI=1S/C26H39N3.C3H6O/c1-4-5-23-14-25(15-23)24-8-6-21(7-9-24)17-28-12-10-22(11-13-28)18-29-19-26(16-27-29)20(2)3;1-2-3-4/h6-9,16,19-20,22-23,25H,4-5,10-15,17-18H2,1-3H3;3H,2H2,1H3 |
| InChIKey | LMEFUCGPZJIBLA-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|