C30H42N4O2 — CID 163402559
acetylene;ethane;(2E)-2-(1-methyl-6-piperidin-4-yl-1,3-diazinan-2-ylidene)-3-(4-phenylmethoxyphenyl)propanamide (PubChem CID 163402559) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is acetylene;ethane;(2E)-2-(1-methyl-6-piperidin-4-yl-1,3-diazinan-2-ylidene)-3-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | acetylene;ethane;(2E)-2-(1-methyl-6-piperidin-4-yl-1,3-diazinan-2-ylidene)-3-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 163402559 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | acetylene;ethane;(2E)-2-(1-methyl-6-piperidin-4-yl-1,3-diazinan-2-ylidene)-3-(4-phenylmethoxyphenyl)propanamide |
| SMILES | C#C.CC.CN1/C(=C(\Cc2ccc(OCc3ccccc3)cc2)C(N)=O)NCCC1C1CCNCC1 |
| InChI | InChI=1S/C26H34N4O2.C2H6.C2H2/c1-30-24(21-11-14-28-15-12-21)13-16-29-26(30)23(25(27)31)17-19-7-9-22(10-8-19)32-18-20-5-3-2-4-6-20;2*1-2/h2-10,21,24,28-29H,11-18H2,1H3,(H2,27,31);1-2H3;1-2H/b26-23+;; |
| InChIKey | WUYPGPNTFGRENL-KYAAJVPUSA-N |
| XLogP | 4.07 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|