C19H22ClN3O2 — CID 163404581
tert-butyl N-[[1-(3-chloro-5-pyridin-3-yl-2-pyridinyl)cyclopropyl]methyl]carbamate (PubChem CID 163404581) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is tert-butyl N-[[1-(3-chloro-5-pyridin-3-yl-2-pyridinyl)cyclopropyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(3-chloro-5-pyridin-3-yl-2-pyridinyl)cyclopropyl]methyl]carbamate |
|---|---|
| PubChem CID | 163404581 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | tert-butyl N-[[1-(3-chloro-5-pyridin-3-yl-2-pyridinyl)cyclopropyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(c2ncc(-c3cccnc3)cc2Cl)CC1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-18(2,3)25-17(24)23-12-19(6-7-19)16-15(20)9-14(11-22-16)13-5-4-8-21-10-13/h4-5,8-11H,6-7,12H2,1-3H3,(H,23,24) |
| InChIKey | GKJWLZQXLAUFKB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |