C26H20Cl2N2O3S — CID 163405653
5-benzyl-2-[[3-[(2,4-dichlorophenoxy)methyl]benzoyl]amino]thiophene-3-carboxamide (PubChem CID 163405653) has the molecular formula C26H20Cl2N2O3S and a molecular weight of 511.43 g/mol. Its IUPAC name is 5-benzyl-2-[[3-[(2,4-dichlorophenoxy)methyl]benzoyl]amino]thiophene-3-carboxamide.
| Compound Name | 5-benzyl-2-[[3-[(2,4-dichlorophenoxy)methyl]benzoyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 163405653 |
| Molecular Formula | C26H20Cl2N2O3S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 5-benzyl-2-[[3-[(2,4-dichlorophenoxy)methyl]benzoyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1cc(Cc2ccccc2)sc1NC(=O)c1cccc(COc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C26H20Cl2N2O3S/c27-19-9-10-23(22(28)13-19)33-15-17-7-4-8-18(11-17)25(32)30-26-21(24(29)31)14-20(34-26)12-16-5-2-1-3-6-16/h1-11,13-14H,12,15H2,(H2,29,31)(H,30,32) |
| InChIKey | HOWOGNPRBJCYLY-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |