C26H20Cl2N2O3 — CID 69070014
3-[(2,5-dichlorophenoxy)methyl]-N-(3-phenylmethoxy-2-pyridinyl)benzamide (PubChem CID 69070014) has the molecular formula C26H20Cl2N2O3 and a molecular weight of 479.36 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenoxy)methyl]-N-(3-phenylmethoxy-2-pyridinyl)benzamide.
| Compound Name | 3-[(2,5-dichlorophenoxy)methyl]-N-(3-phenylmethoxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 69070014 |
| Molecular Formula | C26H20Cl2N2O3 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 3-[(2,5-dichlorophenoxy)methyl]-N-(3-phenylmethoxy-2-pyridinyl)benzamide |
| SMILES | O=C(Nc1ncccc1OCc1ccccc1)c1cccc(COc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C26H20Cl2N2O3/c27-21-11-12-22(28)24(15-21)33-17-19-8-4-9-20(14-19)26(31)30-25-23(10-5-13-29-25)32-16-18-6-2-1-3-7-18/h1-15H,16-17H2,(H,29,30,31) |
| InChIKey | LVKNUACZKJVIIG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |