C27H32N2O3 — CID 139945086
3,5-ditert-butyl-4-hydroxy-N-(3-phenylmethoxy-2-pyridinyl)benzamide (PubChem CID 139945086) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxy-N-(3-phenylmethoxy-2-pyridinyl)benzamide.
| Compound Name | 3,5-ditert-butyl-4-hydroxy-N-(3-phenylmethoxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 139945086 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxy-N-(3-phenylmethoxy-2-pyridinyl)benzamide |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2ncccc2OCc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H32N2O3/c1-26(2,3)20-15-19(16-21(23(20)30)27(4,5)6)25(31)29-24-22(13-10-14-28-24)32-17-18-11-8-7-9-12-18/h7-16,30H,17H2,1-6H3,(H,28,29,31) |
| InChIKey | ZIVPYZBSPGELNE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |