C19H16N4 — CID 163406172
3-imino-6-N-(4-methylphenyl)benzo[f]isoindole-1,6-diamine (PubChem CID 163406172) has the molecular formula C19H16N4 and a molecular weight of 300.37 g/mol. Its IUPAC name is 3-imino-6-N-(4-methylphenyl)benzo[f]isoindole-1,6-diamine.
| Compound Name | 3-imino-6-N-(4-methylphenyl)benzo[f]isoindole-1,6-diamine |
|---|---|
| PubChem CID | 163406172 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-imino-6-N-(4-methylphenyl)benzo[f]isoindole-1,6-diamine |
| SMILES | [H]/N=C1\N=C(N)c2cc3ccc(Nc4ccc(C)cc4)cc3cc21 |
| InChI | InChI=1S/C19H16N4/c1-11-2-5-14(6-3-11)22-15-7-4-12-9-16-17(10-13(12)8-15)19(21)23-18(16)20/h2-10,22H,1H3,(H3,20,21,23) |
| InChIKey | YIIDSVYCCHEPKO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|