C19H39NO3Si — CID 163406222
tert-butyl (6R)-6-[[butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpiperidine-1-carboxylate (PubChem CID 163406222) has the molecular formula C19H39NO3Si and a molecular weight of 357.61 g/mol. Its IUPAC name is tert-butyl (6R)-6-[[butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (6R)-6-[[butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 163406222 |
| Molecular Formula | C19H39NO3Si |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | tert-butyl (6R)-6-[[butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylpiperidine-1-carboxylate |
| SMILES | CCCC[Si](C)(C)OC[C@H]1CCCC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H39NO3Si/c1-9-10-14-24(7,8)22-15-16-12-11-13-19(5,6)20(16)17(21)23-18(2,3)4/h16H,9-15H2,1-8H3/t16-/m1/s1 |
| InChIKey | AJSMTSVJMUBNOO-MRXNPFEDSA-N |
| XLogP | 5.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|