C17H23N3O5 — CID 163407470
tert-butyl N-[3-[[3-(2-cyanoacetyl)-4-methoxy-2-pyridinyl]oxy]propyl]carbamate (PubChem CID 163407470) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-(2-cyanoacetyl)-4-methoxy-2-pyridinyl]oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[3-(2-cyanoacetyl)-4-methoxy-2-pyridinyl]oxy]propyl]carbamate |
|---|---|
| PubChem CID | 163407470 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | tert-butyl N-[3-[[3-(2-cyanoacetyl)-4-methoxy-2-pyridinyl]oxy]propyl]carbamate |
| SMILES | COc1ccnc(OCCCNC(=O)OC(C)(C)C)c1C(=O)CC#N |
| InChI | InChI=1S/C17H23N3O5/c1-17(2,3)25-16(22)20-9-5-11-24-15-14(12(21)6-8-18)13(23-4)7-10-19-15/h7,10H,5-6,9,11H2,1-4H3,(H,20,22) |
| InChIKey | DPMTXESNBODVNQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|