C19H20IN3O2 — CID 163408659
5-(4-methylphenyl)-N-[1-(1-methylpyridin-1-ium-4-yl)ethyl]-1,2-oxazole-3-carboxamide iodide (PubChem CID 163408659) has the molecular formula C19H20IN3O2 and a molecular weight of 449.29 g/mol. Its IUPAC name is 5-(4-methylphenyl)-N-[1-(1-methylpyridin-1-ium-4-yl)ethyl]-1,2-oxazole-3-carboxamide iodide.
| Compound Name | 5-(4-methylphenyl)-N-[1-(1-methylpyridin-1-ium-4-yl)ethyl]-1,2-oxazole-3-carboxamide iodide |
|---|---|
| PubChem CID | 163408659 |
| Molecular Formula | C19H20IN3O2 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 5-(4-methylphenyl)-N-[1-(1-methylpyridin-1-ium-4-yl)ethyl]-1,2-oxazole-3-carboxamide iodide |
| SMILES | Cc1ccc(-c2cc(C(=O)NC(C)c3cc[n+](C)cc3)no2)cc1.[I-] |
| InChI | InChI=1S/C19H19N3O2.HI/c1-13-4-6-16(7-5-13)18-12-17(21-24-18)19(23)20-14(2)15-8-10-22(3)11-9-15;/h4-12,14H,1-3H3;1H |
| InChIKey | DZXJEOFQFAIINQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 59.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|