C25H29BrN2O — CID 163409463
1-(oxan-4-yl)-3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium bromide (PubChem CID 163409463) has the molecular formula C25H29BrN2O and a molecular weight of 453.42 g/mol. Its IUPAC name is 1-(oxan-4-yl)-3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium bromide.
| Compound Name | 1-(oxan-4-yl)-3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium bromide |
|---|---|
| PubChem CID | 163409463 |
| Molecular Formula | C25H29BrN2O |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 1-(oxan-4-yl)-3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium bromide |
| SMILES | [Br-].c1ccc(-c2ccc(-c3c[n+](C4CCOCC4)c4n3CCCCC4)cc2)cc1 |
| InChI | InChI=1S/C25H29N2O.BrH/c1-3-7-20(8-4-1)21-10-12-22(13-11-21)24-19-27(23-14-17-28-18-15-23)25-9-5-2-6-16-26(24)25;/h1,3-4,7-8,10-13,19,23H,2,5-6,9,14-18H2;1H/q+1;/p-1 |
| InChIKey | QFUSUOBLWLGSHI-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|