C12H22O5 — CID 163409519
(2R,3R,4R,6R)-3,4-dimethoxy-2-(methoxymethyl)-6-prop-2-enoxyoxane (PubChem CID 163409519) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (2R,3R,4R,6R)-3,4-dimethoxy-2-(methoxymethyl)-6-prop-2-enoxyoxane.
| Compound Name | (2R,3R,4R,6R)-3,4-dimethoxy-2-(methoxymethyl)-6-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 163409519 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2R,3R,4R,6R)-3,4-dimethoxy-2-(methoxymethyl)-6-prop-2-enoxyoxane |
| SMILES | C=CCO[C@H]1C[C@@H](OC)[C@@H](OC)[C@@H](COC)O1 |
| InChI | InChI=1S/C12H22O5/c1-5-6-16-11-7-9(14-3)12(15-4)10(17-11)8-13-2/h5,9-12H,1,6-8H2,2-4H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | NOFSHGNQHANNEC-DDHJBXDOSA-N |
| XLogP | 0.98 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|