C16H13FN3O2+ — CID 163410081
2-amino-3-(4-fluorobenzoyl)-5H-indolizin-4-ium-1-carboxamide (PubChem CID 163410081) has the molecular formula C16H13FN3O2+ and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-amino-3-(4-fluorobenzoyl)-5H-indolizin-4-ium-1-carboxamide.
| Compound Name | 2-amino-3-(4-fluorobenzoyl)-5H-indolizin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 163410081 |
| Molecular Formula | C16H13FN3O2+ |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-amino-3-(4-fluorobenzoyl)-5H-indolizin-4-ium-1-carboxamide |
| SMILES | NC(=O)C1=C(N)C(C(=O)c2ccc(F)cc2)=[N+]2CC=CC=C12 |
| InChI | InChI=1S/C16H12FN3O2/c17-10-6-4-9(5-7-10)15(21)14-13(18)12(16(19)22)11-3-1-2-8-20(11)14/h1-7H,8H2,(H3-,18,19,22)/p+1 |
| InChIKey | LNXVVCBJDDZBQI-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|