C12H16N2O4S — CID 163410349
(3S)-1-[4-(2,5-dioxopyrrolidin-1-yl)butyl]-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 163410349) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is (3S)-1-[4-(2,5-dioxopyrrolidin-1-yl)butyl]-3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | (3S)-1-[4-(2,5-dioxopyrrolidin-1-yl)butyl]-3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 163410349 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (3S)-1-[4-(2,5-dioxopyrrolidin-1-yl)butyl]-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCCCN1C(=O)C[C@H](S)C1=O |
| InChI | InChI=1S/C12H16N2O4S/c15-9-3-4-10(16)13(9)5-1-2-6-14-11(17)7-8(19)12(14)18/h8,19H,1-7H2/t8-/m0/s1 |
| InChIKey | YPRYBTMQMKSBCL-QMMMGPOBSA-N |
| XLogP | -0.03 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|